C19H29Cl2N3O3S — CID 43898491
2-(2,4-dichloro-N-methylsulfonylanilino)-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide (PubChem CID 43898491) has the molecular formula C19H29Cl2N3O3S and a molecular weight of 450.43 g/mol. Its IUPAC name is 2-(2,4-dichloro-N-methylsulfonylanilino)-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-(2,4-dichloro-N-methylsulfonylanilino)-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 43898491 |
| Molecular Formula | C19H29Cl2N3O3S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-(2,4-dichloro-N-methylsulfonylanilino)-N-[3-(2-ethylpiperidin-1-yl)propyl]acetamide |
| SMILES | CCC1CCCCN1CCCNC(=O)CN(c1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C19H29Cl2N3O3S/c1-3-16-7-4-5-11-23(16)12-6-10-22-19(25)14-24(28(2,26)27)18-9-8-15(20)13-17(18)21/h8-9,13,16H,3-7,10-12,14H2,1-2H3,(H,22,25) |
| InChIKey | DGWAXIBEQLMMOC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|