C19H28Cl2N2O — CID 100596826
3-(3,4-dichlorophenyl)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]propanamide (PubChem CID 100596826) has the molecular formula C19H28Cl2N2O and a molecular weight of 371.35 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 100596826 |
| Molecular Formula | C19H28Cl2N2O |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]propanamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H28Cl2N2O/c1-2-16-6-3-4-12-23(16)13-5-11-22-19(24)10-8-15-7-9-17(20)18(21)14-15/h7,9,14,16H,2-6,8,10-13H2,1H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | HKYHNDGHWXBEEV-MRXNPFEDSA-N |
| XLogP | 4.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|