C22H34ClN3O3S — CID 92882504
2-chloro-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 92882504) has the molecular formula C22H34ClN3O3S and a molecular weight of 456.05 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 92882504 |
| Molecular Formula | C22H34ClN3O3S |
| Molecular Weight | 456.05 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-chloro-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C22H34ClN3O3S/c1-2-18-9-4-7-13-25(18)14-8-12-24-22(27)20-17-19(10-11-21(20)23)30(28,29)26-15-5-3-6-16-26/h10-11,17-18H,2-9,12-16H2,1H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | CASCXLRMHMMJAT-GOSISDBHSA-N |
| XLogP | 3.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.05 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|