C24H32ClN3O3S — CID 43876108
3-chloro-N-[3-(2-ethylpiperidin-1-yl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 43876108) has the molecular formula C24H32ClN3O3S and a molecular weight of 478.06 g/mol. Its IUPAC name is 3-chloro-N-[3-(2-ethylpiperidin-1-yl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | 3-chloro-N-[3-(2-ethylpiperidin-1-yl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 43876108 |
| Molecular Formula | C24H32ClN3O3S |
| Molecular Weight | 478.06 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-chloro-N-[3-(2-ethylpiperidin-1-yl)propyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | CCC1CCCCN1CCCNC(=O)c1ccc(NS(=O)(=O)c2ccc(C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H32ClN3O3S/c1-3-20-7-4-5-15-28(20)16-6-14-26-24(29)19-10-13-23(22(25)17-19)27-32(30,31)21-11-8-18(2)9-12-21/h8-13,17,20,27H,3-7,14-16H2,1-2H3,(H,26,29) |
| InChIKey | RJZTVMSJTIAUBP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.06 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|