C24H39N3O4S — CID 133265295
N-[3-(2-ethylpiperidin-1-yl)propyl]-3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 133265295) has the molecular formula C24H39N3O4S and a molecular weight of 465.66 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 133265295 |
| Molecular Formula | C24H39N3O4S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CCC1CCCCN1CCCNC(=O)CCc1cc(S(=O)(=O)N2CCCC2)ccc1OC |
| InChI | InChI=1S/C24H39N3O4S/c1-3-21-9-4-5-15-26(21)16-8-14-25-24(28)13-10-20-19-22(11-12-23(20)31-2)32(29,30)27-17-6-7-18-27/h11-12,19,21H,3-10,13-18H2,1-2H3,(H,25,28) |
| InChIKey | ZYXIIRUCNKUUAV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|