C26H35N3O4S — CID 125048979
3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]propanamide (PubChem CID 125048979) has the molecular formula C26H35N3O4S and a molecular weight of 485.65 g/mol. Its IUPAC name is 3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]propanamide.
| Compound Name | 3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 125048979 |
| Molecular Formula | C26H35N3O4S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)-N-[3-[(2R)-2-methyl-2,3-dihydroindol-1-yl]propyl]propanamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1CCC(=O)NCCCN1c2ccccc2C[C@H]1C |
| InChI | InChI=1S/C26H35N3O4S/c1-20-18-21-8-3-4-9-24(21)29(20)17-7-14-27-26(30)13-10-22-19-23(11-12-25(22)33-2)34(31,32)28-15-5-6-16-28/h3-4,8-9,11-12,19-20H,5-7,10,13-18H2,1-2H3,(H,27,30)/t20-/m1/s1 |
| InChIKey | FQZNXYNNDKRHMS-HXUWFJFHSA-N |
| XLogP | 3.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|