C17H26ClN3O — CID 95706022
1-(3-chlorophenyl)-3-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]urea (PubChem CID 95706022) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 95706022 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]urea |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H26ClN3O/c1-2-16-9-3-4-11-21(16)12-6-10-19-17(22)20-15-8-5-7-14(18)13-15/h5,7-8,13,16H,2-4,6,9-12H2,1H3,(H2,19,20,22)/t16-/m1/s1 |
| InChIKey | DDOBEKUQEFUIRQ-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|