C19H29ClN2O2 — CID 94018587
(2R)-2-(3-chlorophenoxy)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]propanamide (PubChem CID 94018587) has the molecular formula C19H29ClN2O2 and a molecular weight of 352.91 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]propanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 94018587 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]propanamide |
| SMILES | CC[C@H]1CCCCN1CCCNC(=O)[C@@H](C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H29ClN2O2/c1-3-17-9-4-5-12-22(17)13-7-11-21-19(23)15(2)24-18-10-6-8-16(20)14-18/h6,8,10,14-15,17H,3-5,7,9,11-13H2,1-2H3,(H,21,23)/t15-,17+/m1/s1 |
| InChIKey | YGDPWPHHMVDSEE-WBVHZDCISA-N |
| XLogP | 3.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|