C22H36N2O2 — CID 125042983
(2S)-2-(2,5-dimethylphenoxy)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]butanamide (PubChem CID 125042983) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethylphenoxy)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]butanamide.
| Compound Name | (2S)-2-(2,5-dimethylphenoxy)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 125042983 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | (2S)-2-(2,5-dimethylphenoxy)-N-[3-[(2R)-2-ethylpiperidin-1-yl]propyl]butanamide |
| SMILES | CC[C@@H]1CCCCN1CCCNC(=O)[C@H](CC)Oc1cc(C)ccc1C |
| InChI | InChI=1S/C22H36N2O2/c1-5-19-10-7-8-14-24(19)15-9-13-23-22(25)20(6-2)26-21-16-17(3)11-12-18(21)4/h11-12,16,19-20H,5-10,13-15H2,1-4H3,(H,23,25)/t19-,20+/m1/s1 |
| InChIKey | HTGICZVNLJPYDU-UXHICEINSA-N |
| XLogP | 4.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|