C23H30N2O2 — CID 92646509
(2S)-2-(2,5-dimethylphenoxy)-N-[(4-pyrrolidin-1-ylphenyl)methyl]butanamide (PubChem CID 92646509) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethylphenoxy)-N-[(4-pyrrolidin-1-ylphenyl)methyl]butanamide.
| Compound Name | (2S)-2-(2,5-dimethylphenoxy)-N-[(4-pyrrolidin-1-ylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 92646509 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (2S)-2-(2,5-dimethylphenoxy)-N-[(4-pyrrolidin-1-ylphenyl)methyl]butanamide |
| SMILES | CC[C@H](Oc1cc(C)ccc1C)C(=O)NCc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-4-21(27-22-15-17(2)7-8-18(22)3)23(26)24-16-19-9-11-20(12-10-19)25-13-5-6-14-25/h7-12,15,21H,4-6,13-14,16H2,1-3H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | GFHKYCAEDGPGSK-NRFANRHFSA-N |
| XLogP | 4.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|