C24H32N2O2 — CID 100600862
(2S)-2-(5-methyl-2-propan-2-ylphenoxy)-N-[(4-pyrrolidin-1-ylphenyl)methyl]propanamide (PubChem CID 100600862) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2S)-2-(5-methyl-2-propan-2-ylphenoxy)-N-[(4-pyrrolidin-1-ylphenyl)methyl]propanamide.
| Compound Name | (2S)-2-(5-methyl-2-propan-2-ylphenoxy)-N-[(4-pyrrolidin-1-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 100600862 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | (2S)-2-(5-methyl-2-propan-2-ylphenoxy)-N-[(4-pyrrolidin-1-ylphenyl)methyl]propanamide |
| SMILES | Cc1ccc(C(C)C)c(O[C@@H](C)C(=O)NCc2ccc(N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C24H32N2O2/c1-17(2)22-12-7-18(3)15-23(22)28-19(4)24(27)25-16-20-8-10-21(11-9-20)26-13-5-6-14-26/h7-12,15,17,19H,5-6,13-14,16H2,1-4H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | YDEXMIXONRVJOZ-IBGZPJMESA-N |
| XLogP | 4.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|