C19H29ClN2O2 — CID 99952072
(2S)-2-(3-chlorophenoxy)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]propanamide (PubChem CID 99952072) has the molecular formula C19H29ClN2O2 and a molecular weight of 352.91 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]propanamide.
| Compound Name | (2S)-2-(3-chlorophenoxy)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 99952072 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]propanamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=O)[C@H](C)Oc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H29ClN2O2/c1-14-10-15(2)13-22(12-14)9-5-8-21-19(23)16(3)24-18-7-4-6-17(20)11-18/h4,6-7,11,14-16H,5,8-10,12-13H2,1-3H3,(H,21,23)/t14-,15-,16+/m1/s1 |
| InChIKey | IQZFMELLLJIXEM-OAGGEKHMSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|