C21H34N2O2 — CID 92684252
(2S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-(3-methylphenoxy)butanamide (PubChem CID 92684252) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is (2S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-(3-methylphenoxy)butanamide.
| Compound Name | (2S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 92684252 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | (2S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-(3-methylphenoxy)butanamide |
| SMILES | CC[C@H](Oc1cccc(C)c1)C(=O)NCCCN1C[C@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C21H34N2O2/c1-5-20(25-19-9-6-8-16(2)13-19)21(24)22-10-7-11-23-14-17(3)12-18(4)15-23/h6,8-9,13,17-18,20H,5,7,10-12,14-15H2,1-4H3,(H,22,24)/t17-,18-,20+/m1/s1 |
| InChIKey | XUYKJJGQDOBIFX-GGPKGHCWSA-N |
| XLogP | 3.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|