C18H28ClN3O2 — CID 28564718
(2R)-2-(3-chlorophenoxy)-N-[3-(4-methylpiperazin-1-yl)propyl]butanamide (PubChem CID 28564718) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[3-(4-methylpiperazin-1-yl)propyl]butanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[3-(4-methylpiperazin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 28564718 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[3-(4-methylpiperazin-1-yl)propyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc(Cl)c1)C(=O)NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C18H28ClN3O2/c1-3-17(24-16-7-4-6-15(19)14-16)18(23)20-8-5-9-22-12-10-21(2)11-13-22/h4,6-7,14,17H,3,5,8-13H2,1-2H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | SIWZAIUKKAZUFD-QGZVFWFLSA-N |
| XLogP | 2.25 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|