C20H24ClNO3 — CID 94019406
(2R)-2-(3-chlorophenoxy)-N-[3-(3-methoxyphenyl)propyl]butanamide (PubChem CID 94019406) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[3-(3-methoxyphenyl)propyl]butanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[3-(3-methoxyphenyl)propyl]butanamide |
|---|---|
| PubChem CID | 94019406 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[3-(3-methoxyphenyl)propyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc(Cl)c1)C(=O)NCCCc1cccc(OC)c1 |
| InChI | InChI=1S/C20H24ClNO3/c1-3-19(25-18-11-5-9-16(21)14-18)20(23)22-12-6-8-15-7-4-10-17(13-15)24-2/h4-5,7,9-11,13-14,19H,3,6,8,12H2,1-2H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | GIZPGJLIKFQREB-LJQANCHMSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|