C21H34N2O3 — CID 28631887
(2S)-N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-(3-methoxyphenoxy)butanamide (PubChem CID 28631887) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is (2S)-N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-(3-methoxyphenoxy)butanamide.
| Compound Name | (2S)-N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-(3-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 28631887 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (2S)-N-[3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-(3-methoxyphenoxy)butanamide |
| SMILES | CC[C@H](Oc1cccc(OC)c1)C(=O)NCCCN1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C21H34N2O3/c1-5-20(26-19-9-6-8-18(13-19)25-4)21(24)22-10-7-11-23-14-16(2)12-17(3)15-23/h6,8-9,13,16-17,20H,5,7,10-12,14-15H2,1-4H3,(H,22,24)/t16-,17+,20-/m0/s1 |
| InChIKey | RGPWJQRNVGIHFY-QKLQHJQFSA-N |
| XLogP | 3.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|