C20H32N2O3 — CID 78879562
2-(2,5-dimethoxyphenyl)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]acetamide (PubChem CID 78879562) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 78879562 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]acetamide |
| SMILES | COc1ccc(OC)c(CC(=O)NCCCN2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C20H32N2O3/c1-15-10-16(2)14-22(13-15)9-5-8-21-20(23)12-17-11-18(24-3)6-7-19(17)25-4/h6-7,11,15-16H,5,8-10,12-14H2,1-4H3,(H,21,23) |
| InChIKey | KBCZUHAYZRIEMV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|