C28H37N3O4 — CID 92656068
(1R)-2-[(2,5-dimethoxyphenyl)methyl]-N-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 92656068) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is (1R)-2-[(2,5-dimethoxyphenyl)methyl]-N-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | (1R)-2-[(2,5-dimethoxyphenyl)methyl]-N-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 92656068 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | (1R)-2-[(2,5-dimethoxyphenyl)methyl]-N-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | COc1ccc(OC)c(CN2C(=O)c3ccccc3[C@@H]2C(=O)NCCCN2C[C@H](C)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C28H37N3O4/c1-19-14-20(2)17-30(16-19)13-7-12-29-27(32)26-23-8-5-6-9-24(23)28(33)31(26)18-21-15-22(34-3)10-11-25(21)35-4/h5-6,8-11,15,19-20,26H,7,12-14,16-18H2,1-4H3,(H,29,32)/t19-,20+,26-/m1/s1 |
| InChIKey | RFSLFXTYEZZUIR-BVFVYWQFSA-N |
| XLogP | 3.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|