C22H37N3O3 — CID 98953347
1-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]urea (PubChem CID 98953347) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]urea.
| Compound Name | 1-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 98953347 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 1-[(1R)-1-(2,4-dimethoxyphenyl)ethyl]-3-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]urea |
| SMILES | COc1ccc([C@@H](C)NC(=O)NCCCCN2C[C@H](C)C[C@H](C)C2)c(OC)c1 |
| InChI | InChI=1S/C22H37N3O3/c1-16-12-17(2)15-25(14-16)11-7-6-10-23-22(26)24-18(3)20-9-8-19(27-4)13-21(20)28-5/h8-9,13,16-18H,6-7,10-12,14-15H2,1-5H3,(H2,23,24,26)/t16-,17+,18-/m1/s1 |
| InChIKey | MSSRICLKSTZNHL-FGTMMUONSA-N |
| XLogP | 3.82 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|