C18H24N4O3 — CID 51083709
1-[1-(2,4-dimethoxyphenyl)ethyl]-3-[2-(pyridin-2-ylamino)ethyl]urea (PubChem CID 51083709) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[1-(2,4-dimethoxyphenyl)ethyl]-3-[2-(pyridin-2-ylamino)ethyl]urea.
| Compound Name | 1-[1-(2,4-dimethoxyphenyl)ethyl]-3-[2-(pyridin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 51083709 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[1-(2,4-dimethoxyphenyl)ethyl]-3-[2-(pyridin-2-ylamino)ethyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)NCCNc2ccccn2)c(OC)c1 |
| InChI | InChI=1S/C18H24N4O3/c1-13(15-8-7-14(24-2)12-16(15)25-3)22-18(23)21-11-10-20-17-6-4-5-9-19-17/h4-9,12-13H,10-11H2,1-3H3,(H,19,20)(H2,21,22,23) |
| InChIKey | XKLAXQPOMQKJPH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|