C17H17N5O2 — CID 166386362
7-methoxy-N-[2-(pyridin-2-ylamino)ethyl]cinnoline-3-carboxamide (PubChem CID 166386362) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 7-methoxy-N-[2-(pyridin-2-ylamino)ethyl]cinnoline-3-carboxamide.
| Compound Name | 7-methoxy-N-[2-(pyridin-2-ylamino)ethyl]cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 166386362 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 7-methoxy-N-[2-(pyridin-2-ylamino)ethyl]cinnoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NCCNc3ccccn3)nnc2c1 |
| InChI | InChI=1S/C17H17N5O2/c1-24-13-6-5-12-10-15(22-21-14(12)11-13)17(23)20-9-8-19-16-4-2-3-7-18-16/h2-7,10-11H,8-9H2,1H3,(H,18,19)(H,20,23) |
| InChIKey | QXKJTYFOBQPZPF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|