C24H26N8O3 — CID 122288870
3-(2,5-dimethoxyphenyl)-1-methyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]pyrazole-5-carboxamide (PubChem CID 122288870) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-methyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]pyrazole-5-carboxamide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-methyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122288870 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-methyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]pyrazole-5-carboxamide |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)NCCNc3ccc(Nc4ccccn4)nn3)n(C)n2)c1 |
| InChI | InChI=1S/C24H26N8O3/c1-32-19(15-18(31-32)17-14-16(34-2)7-8-20(17)35-3)24(33)27-13-12-26-22-9-10-23(30-29-22)28-21-6-4-5-11-25-21/h4-11,14-15H,12-13H2,1-3H3,(H,26,29)(H,27,33)(H,25,28,30) |
| InChIKey | SZWQJEJKDVVPBC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|