C24H31N7O3 — CID 122294915
3-(2,5-dimethoxyphenyl)-1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]pyrazole-5-carboxamide (PubChem CID 122294915) has the molecular formula C24H31N7O3 and a molecular weight of 465.56 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]pyrazole-5-carboxamide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122294915 |
| Molecular Formula | C24H31N7O3 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]pyrazole-5-carboxamide |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)NCCNc3nc(C)cc(N4CCCC4)n3)n(C)n2)c1 |
| InChI | InChI=1S/C24H31N7O3/c1-16-13-22(31-11-5-6-12-31)28-24(27-16)26-10-9-25-23(32)20-15-19(29-30(20)2)18-14-17(33-3)7-8-21(18)34-4/h7-8,13-15H,5-6,9-12H2,1-4H3,(H,25,32)(H,26,27,28) |
| InChIKey | YDPAGULFUSNQKK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|