C23H29N7O2 — CID 122294975
3-(3-methoxyphenyl)-1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]pyrazole-5-carboxamide (PubChem CID 122294975) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]pyrazole-5-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122294975 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-methyl-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NCCNc3nc(C)cc(N4CCCC4)n3)n(C)n2)c1 |
| InChI | InChI=1S/C23H29N7O2/c1-16-13-21(30-11-4-5-12-30)27-23(26-16)25-10-9-24-22(31)20-15-19(28-29(20)2)17-7-6-8-18(14-17)32-3/h6-8,13-15H,4-5,9-12H2,1-3H3,(H,24,31)(H,25,26,27) |
| InChIKey | PXVMHMBERHFFRA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|