C22H24N8O2 — CID 122328408
3-(3-methoxyphenyl)-1-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]pyrazole-5-carboxamide (PubChem CID 122328408) has the molecular formula C22H24N8O2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]pyrazole-5-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-1-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122328408 |
| Molecular Formula | C22H24N8O2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-methyl-N-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NCCNc3cc(-n4ccc(C)n4)ncn3)n(C)n2)c1 |
| InChI | InChI=1S/C22H24N8O2/c1-15-7-10-30(27-15)21-13-20(25-14-26-21)23-8-9-24-22(31)19-12-18(28-29(19)2)16-5-4-6-17(11-16)32-3/h4-7,10-14H,8-9H2,1-3H3,(H,24,31)(H,23,25,26) |
| InChIKey | ABJNMJFDTFGJCN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|