C16H19N3O4 — CID 95129792
1-[(2R)-2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-pyridin-2-ylurea (PubChem CID 95129792) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-[(2R)-2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-pyridin-2-ylurea.
| Compound Name | 1-[(2R)-2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 95129792 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-[(2R)-2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-3-pyridin-2-ylurea |
| SMILES | COc1ccc(OC)c([C@@H](O)CNC(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C16H19N3O4/c1-22-11-6-7-14(23-2)12(9-11)13(20)10-18-16(21)19-15-5-3-4-8-17-15/h3-9,13,20H,10H2,1-2H3,(H2,17,18,19,21)/t13-/m0/s1 |
| InChIKey | GAVHNXODOQRWSA-ZDUSSCGKSA-N |
| XLogP | 1.95 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |