C19H30N2O2 — CID 94123444
N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-3-methoxybenzamide (PubChem CID 94123444) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-3-methoxybenzamide.
| Compound Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 94123444 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCCCN2C[C@H](C)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C19H30N2O2/c1-15-11-16(2)14-21(13-15)10-5-4-9-20-19(22)17-7-6-8-18(12-17)23-3/h6-8,12,15-16H,4-5,9-11,13-14H2,1-3H3,(H,20,22)/t15-,16+ |
| InChIKey | RQZRQDRWGILPMV-IYBDPMFKSA-N |
| XLogP | 3.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|