C21H35N3O4S — CID 51948819
N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide (PubChem CID 51948819) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 51948819 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCN2C[C@H](C)C[C@H](C)C2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H35N3O4S/c1-16-12-17(2)15-24(14-16)11-7-6-10-22-21(25)18-8-9-19(28-5)20(13-18)29(26,27)23(3)4/h8-9,13,16-17H,6-7,10-12,14-15H2,1-5H3,(H,22,25)/t16-,17+ |
| InChIKey | CUDCYLZOOXDZIK-CALCHBBNSA-N |
| XLogP | 2.43 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|