C23H32N4O4S — CID 55638847
3-(dimethylsulfamoyl)-4-methoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 55638847) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-methoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55638847 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCCN2CCN(c3ccccc3)CC2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C23H32N4O4S/c1-25(2)32(29,30)22-18-19(10-11-21(22)31-3)23(28)24-12-7-13-26-14-16-27(17-15-26)20-8-5-4-6-9-20/h4-6,8-11,18H,7,12-17H2,1-3H3,(H,24,28) |
| InChIKey | YNYWZKBEQPZTML-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|