C20H33N3O4S — CID 55717312
3-(dimethylsulfamoyl)-4-methoxy-N-[4-(3-methylpiperidin-1-yl)butyl]benzamide (PubChem CID 55717312) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-methoxy-N-[4-(3-methylpiperidin-1-yl)butyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[4-(3-methylpiperidin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 55717312 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[4-(3-methylpiperidin-1-yl)butyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCCCN2CCCC(C)C2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H33N3O4S/c1-16-8-7-13-23(15-16)12-6-5-11-21-20(24)17-9-10-18(27-4)19(14-17)28(25,26)22(2)3/h9-10,14,16H,5-8,11-13,15H2,1-4H3,(H,21,24) |
| InChIKey | MBKSHDOQXWQPHY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|