C21H35N3O4S — CID 125060384
3-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]propanamide (PubChem CID 125060384) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is 3-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]propanamide.
| Compound Name | 3-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 125060384 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 3-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]propanamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C)cc1CCC(=O)NCCCN1CCC[C@H](C)C1 |
| InChI | InChI=1S/C21H35N3O4S/c1-17-7-5-13-24(16-17)14-6-12-22-21(25)11-8-18-15-19(9-10-20(18)28-4)29(26,27)23(2)3/h9-10,15,17H,5-8,11-14,16H2,1-4H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | ODUZNMJLTDCFIH-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|