C22H34N4O3S — CID 93076605
5-(dimethylsulfamoyl)-1-ethyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]indole-2-carboxamide (PubChem CID 93076605) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-1-ethyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]indole-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-1-ethyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 93076605 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 5-(dimethylsulfamoyl)-1-ethyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NCCCN2CCC[C@@H](C)C2)cc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C22H34N4O3S/c1-5-26-20-10-9-19(30(28,29)24(3)4)14-18(20)15-21(26)22(27)23-11-7-13-25-12-6-8-17(2)16-25/h9-10,14-15,17H,5-8,11-13,16H2,1-4H3,(H,23,27)/t17-/m1/s1 |
| InChIKey | CDLMVYHWGOKBAY-QGZVFWFLSA-N |
| XLogP | 2.76 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|