C19H31N3O3S — CID 55782424
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 55782424) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55782424 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)C1 |
| InChI | InChI=1S/C19H31N3O3S/c1-15-12-16(2)14-22(13-15)11-5-10-20-19(23)17-6-8-18(9-7-17)26(24,25)21(3)4/h6-9,15-16H,5,10-14H2,1-4H3,(H,20,23) |
| InChIKey | BLKVCPBNJPLYIU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|