C18H26N4O4S — CID 50802022
5-(dimethylsulfamoyl)-1-methyl-N-(2-morpholin-4-ylethyl)indole-2-carboxamide (PubChem CID 50802022) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-1-methyl-N-(2-morpholin-4-ylethyl)indole-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-1-methyl-N-(2-morpholin-4-ylethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 50802022 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 5-(dimethylsulfamoyl)-1-methyl-N-(2-morpholin-4-ylethyl)indole-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)cc(C(=O)NCCN1CCOCC1)n2C |
| InChI | InChI=1S/C18H26N4O4S/c1-20(2)27(24,25)15-4-5-16-14(12-15)13-17(21(16)3)18(23)19-6-7-22-8-10-26-11-9-22/h4-5,12-13H,6-11H2,1-3H3,(H,19,23) |
| InChIKey | FRQKIBQHFUUJDW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |