C14H23N3O3S — CID 43453904
N,N-dimethyl-4-(2-morpholin-4-ylethylamino)benzenesulfonamide (PubChem CID 43453904) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-morpholin-4-ylethylamino)benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-(2-morpholin-4-ylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43453904 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N,N-dimethyl-4-(2-morpholin-4-ylethylamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C14H23N3O3S/c1-16(2)21(18,19)14-5-3-13(4-6-14)15-7-8-17-9-11-20-12-10-17/h3-6,15H,7-12H2,1-2H3 |
| InChIKey | ZPSSNDBOWZSIAW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |