C18H32IN5O3S — CID 111187808
2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111187808) has the molecular formula C18H32IN5O3S and a molecular weight of 525.46 g/mol. Its IUPAC name is 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111187808 |
| Molecular Formula | C18H32IN5O3S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)cc1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C18H31N5O3S.HI/c1-4-19-18(20-9-10-23-11-13-26-14-12-23)21-15-16-5-7-17(8-6-16)27(24,25)22(2)3;/h5-8H,4,9-15H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | HMZOTXKRXOYJEG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|