C19H34IN5O3S — CID 110972892
2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 110972892) has the molecular formula C19H34IN5O3S and a molecular weight of 539.48 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110972892 |
| Molecular Formula | C19H34IN5O3S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C19H33N5O3S.HI/c1-4-20-19(21-10-7-11-24-12-14-27-15-13-24)22-16-17-8-5-6-9-18(17)28(25,26)23(2)3;/h5-6,8-9H,4,7,10-16H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | WIKWNJRFKJTTNQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|