C18H32N4O2S — CID 111160691
2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-hexylguanidine (PubChem CID 111160691) has the molecular formula C18H32N4O2S and a molecular weight of 368.55 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-hexylguanidine.
| Compound Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-hexylguanidine |
|---|---|
| PubChem CID | 111160691 |
| Molecular Formula | C18H32N4O2S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-hexylguanidine |
| SMILES | CCCCCCN/C(=N/Cc1ccccc1S(=O)(=O)N(C)C)NCC |
| InChI | InChI=1S/C18H32N4O2S/c1-5-7-8-11-14-20-18(19-6-2)21-15-16-12-9-10-13-17(16)25(23,24)22(3)4/h9-10,12-13H,5-8,11,14-15H2,1-4H3,(H2,19,20,21) |
| InChIKey | NLCHCCJEMGITCQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|