C23H31N5O2S — CID 111973908
2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111973908) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111973908 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)NCCc1c[nH]c2cc(C)ccc12 |
| InChI | InChI=1S/C23H31N5O2S/c1-5-24-23(25-13-12-18-15-26-21-14-17(2)10-11-20(18)21)27-16-19-8-6-7-9-22(19)31(29,30)28(3)4/h6-11,14-15,26H,5,12-13,16H2,1-4H3,(H2,24,25,27) |
| InChIKey | KGINEFXOQLNMSD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|