C21H35IN4O2S — CID 111635124
2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111635124) has the molecular formula C21H35IN4O2S and a molecular weight of 534.51 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111635124 |
| Molecular Formula | C21H35IN4O2S |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)NCCc1c[nH]c2cc(C)ccc12.I |
| InChI | InChI=1S/C21H34N4O2S.HI/c1-6-22-20(25-15-21(3,4)10-12-28(5,26)27)23-11-9-17-14-24-19-13-16(2)7-8-18(17)19;/h7-8,13-14,24H,6,9-12,15H2,1-5H3,(H2,22,23,25);1H |
| InChIKey | KPYCHYQKNXITSF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|