C13H30IN3O2S — CID 111634795
2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-propylguanidine;hydroiodide (PubChem CID 111634795) has the molecular formula C13H30IN3O2S and a molecular weight of 419.37 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-propylguanidine;hydroiodide.
| Compound Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111634795 |
| Molecular Formula | C13H30IN3O2S |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-propylguanidine;hydroiodide |
| SMILES | CCCN/C(=N/CC(C)(C)CCS(C)(=O)=O)NCC.I |
| InChI | InChI=1S/C13H29N3O2S.HI/c1-6-9-15-12(14-7-2)16-11-13(3,4)8-10-19(5,17)18;/h6-11H2,1-5H3,(H2,14,15,16);1H |
| InChIKey | GYVVIAOISWYRJS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|