C22H40IN3O2S — CID 109465001
2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 109465001) has the molecular formula C22H40IN3O2S and a molecular weight of 537.55 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109465001 |
| Molecular Formula | C22H40IN3O2S |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-[2-(4-ethylphenyl)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)NCC(C)(C)c1ccc(CC)cc1.I |
| InChI | InChI=1S/C22H39N3O2S.HI/c1-8-18-10-12-19(13-11-18)22(5,6)17-25-20(23-9-2)24-16-21(3,4)14-15-28(7,26)27;/h10-13H,8-9,14-17H2,1-7H3,(H2,23,24,25);1H |
| InChIKey | UFFPJJUKBOFJKZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|