C20H36IN3O2S — CID 111772739
2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111772739) has the molecular formula C20H36IN3O2S and a molecular weight of 509.50 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111772739 |
| Molecular Formula | C20H36IN3O2S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)NC(C)CCc1ccccc1.I |
| InChI | InChI=1S/C20H35N3O2S.HI/c1-6-21-19(22-16-20(3,4)14-15-26(5,24)25)23-17(2)12-13-18-10-8-7-9-11-18;/h7-11,17H,6,12-16H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | PSZRQMWTKGSYNC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|