C21H37N3O — CID 111789846
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(4-phenylbutan-2-yl)guanidine (PubChem CID 111789846) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(4-phenylbutan-2-yl)guanidine.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(4-phenylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 111789846 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(4-phenylbutan-2-yl)guanidine |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NC(C)CCc1ccccc1 |
| InChI | InChI=1S/C21H37N3O/c1-5-21(6-2,15-16-25)17-23-20(22-7-3)24-18(4)13-14-19-11-9-8-10-12-19/h8-12,18,25H,5-7,13-17H2,1-4H3,(H2,22,23,24) |
| InChIKey | NXGHDCZVPLLZMK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|