C20H36N4O — CID 111716686
1-(3-anilinopropyl)-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine (PubChem CID 111716686) has the molecular formula C20H36N4O and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine.
| Compound Name | 1-(3-anilinopropyl)-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111716686 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | 1-(3-anilinopropyl)-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCCNc1ccccc1 |
| InChI | InChI=1S/C20H36N4O/c1-4-20(5-2,13-16-25)17-24-19(21-6-3)23-15-10-14-22-18-11-8-7-9-12-18/h7-9,11-12,22,25H,4-6,10,13-17H2,1-3H3,(H2,21,23,24) |
| InChIKey | QVQCOWRUBACHAL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|