C16H36N4O3S — CID 111716198
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine (PubChem CID 111716198) has the molecular formula C16H36N4O3S and a molecular weight of 364.56 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine |
|---|---|
| PubChem CID | 111716198 |
| Molecular Formula | C16H36N4O3S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCCNS(=O)(=O)CC |
| InChI | InChI=1S/C16H36N4O3S/c1-5-16(6-2,10-13-21)14-19-15(17-7-3)18-11-9-12-20-24(22,23)8-4/h20-21H,5-14H2,1-4H3,(H2,17,18,19) |
| InChIKey | XSBPTEWHJBIWKO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|