C18H37IN4O2 — CID 111716771
N-cyclopropyl-4-[[N'-(2,2-diethyl-4-hydroxybutyl)-N-ethylcarbamimidoyl]amino]butanamide;hydroiodide (PubChem CID 111716771) has the molecular formula C18H37IN4O2 and a molecular weight of 468.42 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N'-(2,2-diethyl-4-hydroxybutyl)-N-ethylcarbamimidoyl]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[N'-(2,2-diethyl-4-hydroxybutyl)-N-ethylcarbamimidoyl]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111716771 |
| Molecular Formula | C18H37IN4O2 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-cyclopropyl-4-[[N'-(2,2-diethyl-4-hydroxybutyl)-N-ethylcarbamimidoyl]amino]butanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCCC(=O)NC1CC1.I |
| InChI | InChI=1S/C18H36N4O2.HI/c1-4-18(5-2,11-13-23)14-21-17(19-6-3)20-12-7-8-16(24)22-15-9-10-15;/h15,23H,4-14H2,1-3H3,(H,22,24)(H2,19,20,21);1H |
| InChIKey | DMBZSYMQRUYLRA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|