C15H32IN3O3S — CID 111789831
2-(2,2-diethyl-4-hydroxybutyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111789831) has the molecular formula C15H32IN3O3S and a molecular weight of 461.41 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111789831 |
| Molecular Formula | C15H32IN3O3S |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H31N3O3S.HI/c1-4-15(5-2,8-9-19)12-17-14(16-6-3)18-13-7-10-22(20,21)11-13;/h13,19H,4-12H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | OPLOKBXUVNTGHU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|