C16H33N3O — CID 111789769
1-cyclopentyl-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine (PubChem CID 111789769) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine.
| Compound Name | 1-cyclopentyl-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111789769 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 1-cyclopentyl-2-(2,2-diethyl-4-hydroxybutyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NC1CCCC1 |
| InChI | InChI=1S/C16H33N3O/c1-4-16(5-2,11-12-20)13-18-15(17-6-3)19-14-9-7-8-10-14/h14,20H,4-13H2,1-3H3,(H2,17,18,19) |
| InChIKey | MTGJNKJESUUOKD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|