C17H26BrN3O2S — CID 111143546
2-[2-(4-bromophenyl)-2-methylpropyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine (PubChem CID 111143546) has the molecular formula C17H26BrN3O2S and a molecular weight of 416.39 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2-methylpropyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine.
| Compound Name | 2-[2-(4-bromophenyl)-2-methylpropyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111143546 |
| Molecular Formula | C17H26BrN3O2S |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2-methylpropyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(Br)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26BrN3O2S/c1-4-19-16(21-15-9-10-24(22,23)11-15)20-12-17(2,3)13-5-7-14(18)8-6-13/h5-8,15H,4,9-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | GJMQUCAIXVPMLQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|